About cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone
cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone (PubChem CID 659794) has the molecular formula C17H21N3O
and a molecular weight of 283.37 g/mol. Its IUPAC name is cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone |
| PubChem CID | 659794 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CCCn2c1nc1ccccc12 |
| InChI | InChI=1S/C17H21N3O/c21-16(13-7-2-1-3-8-13)20-12-6-11-19-15-10-5-4-9-14(15)18-17(19)20/h4-5,9-10,13H,1-3,6-8,11-12H2 |
| InChIKey | HVSHHAVGLSAXTH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone?
The IUPAC name of cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone (CID 659794) is cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone.
What is the SMILES notation for cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone?
The canonical SMILES for cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone is O=C(C1CCCCC1)N1CCCn2c1nc1ccccc12.
What is the InChIKey of cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone?
The InChIKey is HVSHHAVGLSAXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c21-16(13-7-2-1-3-8-13)20-12-6-11-19-15-10-5-4-9-14(15)18-17(19)20/h4-5,9-10,13H,1-3,6-8,11-12H2.
What are the key properties of cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone?
cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone has a molecular weight of 283.37 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-1-yl)methanone is sourced from PubChem (CID 659794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).