C14H19N3O2 — CID 659804
2-(3-hydroxypropylamino)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile (PubChem CID 659804) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile.
| Compound Name | 2-(3-hydroxypropylamino)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 659804 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-(3-hydroxypropylamino)-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine-3-carbonitrile |
| SMILES | CC1(C)Cc2nc(NCCCO)c(C#N)cc2CO1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2)7-12-11(9-19-14)6-10(8-15)13(17-12)16-4-3-5-18/h6,18H,3-5,7,9H2,1-2H3,(H,16,17) |
| InChIKey | MPSOSWRNBNEUHN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|