C17H19ClN4O5 — CID 6598296
N-(2-chloro-5-nitrophenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 6598296) has the molecular formula C17H19ClN4O5 and a molecular weight of 394.82 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 6598296 |
| Molecular Formula | C17H19ClN4O5 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C2=O |
| InChI | InChI=1S/C17H19ClN4O5/c1-10-4-2-3-7-17(10)15(24)21(16(25)20-17)9-14(23)19-13-8-11(22(26)27)5-6-12(13)18/h5-6,8,10H,2-4,7,9H2,1H3,(H,19,23)(H,20,25)/t10-,17-/m0/s1 |
| InChIKey | GZKUKGWZFCKGJR-BTDLBPIBSA-N |
| XLogP | 2.69 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|