C17H19F4N3 — CID 659893
1-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]piperidine (PubChem CID 659893) has the molecular formula C17H19F4N3 and a molecular weight of 341.35 g/mol. Its IUPAC name is 1-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]piperidine.
| Compound Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]piperidine |
|---|---|
| PubChem CID | 659893 |
| Molecular Formula | C17H19F4N3 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[[4-(3,5-dimethylpyrazol-1-yl)-2,3,5,6-tetrafluorophenyl]methyl]piperidine |
| SMILES | Cc1cc(C)n(-c2c(F)c(F)c(CN3CCCCC3)c(F)c2F)n1 |
| InChI | InChI=1S/C17H19F4N3/c1-10-8-11(2)24(22-10)17-15(20)13(18)12(14(19)16(17)21)9-23-6-4-3-5-7-23/h8H,3-7,9H2,1-2H3 |
| InChIKey | LDGPWKHEEFQZBY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|