C27H29FN4O — CID 6598931
(1S,4R)-N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine (PubChem CID 6598931) has the molecular formula C27H29FN4O and a molecular weight of 444.55 g/mol. Its IUPAC name is (1S,4R)-N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine.
| Compound Name | (1S,4R)-N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine |
|---|---|
| PubChem CID | 6598931 |
| Molecular Formula | C27H29FN4O |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (1S,4R)-N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]hept-2-en-2-amine |
| SMILES | Cc1nn(-c2ccccc2)c(Oc2ccc(F)cc2)c1/C=N\NC1=C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C27H29FN4O/c1-18-23(17-29-30-24-16-19-14-15-27(24,4)26(19,2)3)25(33-22-12-10-20(28)11-13-22)32(31-18)21-8-6-5-7-9-21/h5-13,16-17,19,30H,14-15H2,1-4H3/b29-17-/t19-,27-/m1/s1 |
| InChIKey | FUPQRCHRGBVTRD-QANBXDEZSA-N |
| XLogP | 6.38 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|