C15H14O4 — CID 659897
5-[(2-prop-1-enylphenoxy)methyl]furan-2-carboxylic acid (PubChem CID 659897) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is 5-[(2-prop-1-enylphenoxy)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-prop-1-enylphenoxy)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 659897 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-[(2-prop-1-enylphenoxy)methyl]furan-2-carboxylic acid |
| SMILES | CC=Cc1ccccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C15H14O4/c1-2-5-11-6-3-4-7-13(11)18-10-12-8-9-14(19-12)15(16)17/h2-9H,10H2,1H3,(H,16,17) |
| InChIKey | UYAGNUNAKUVMAC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |