C9H7Cl2N3S — CID 659915
5-[(3,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 659915) has the molecular formula C9H7Cl2N3S and a molecular weight of 260.15 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 659915 |
| Molecular Formula | C9H7Cl2N3S |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(Cc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C9H7Cl2N3S/c10-6-2-1-5(3-7(6)11)4-8-13-14-9(12)15-8/h1-3H,4H2,(H2,12,14) |
| InChIKey | DAYHQPPTGMEUTM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |