C9H5Cl3N4O — CID 659923
2,3,6-trichloro-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 659923) has the molecular formula C9H5Cl3N4O and a molecular weight of 291.53 g/mol. Its IUPAC name is 2,3,6-trichloro-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2,3,6-trichloro-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 659923 |
| Molecular Formula | C9H5Cl3N4O |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 2,3,6-trichloro-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C9H5Cl3N4O/c10-4-1-2-5(11)7(12)6(4)8(17)15-9-13-3-14-16-9/h1-3H,(H2,13,14,15,16,17) |
| InChIKey | KBDDCRNUQDKWIA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|