About 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol
2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol (PubChem CID 659949) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol |
| PubChem CID | 659949 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol |
| SMILES | Cc1nc(C(C)(C)O)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C12H15N3O/c1-9-13-11(12(2,3)16)15(14-9)10-7-5-4-6-8-10/h4-8,16H,1-3H3 |
| InChIKey | ZDAJSLOGXYNHMJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol?
The IUPAC name of 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol (CID 659949) is 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol.
What is the SMILES notation for 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol?
The canonical SMILES for 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol is Cc1nc(C(C)(C)O)n(-c2ccccc2)n1.
What is the InChIKey of 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol?
The InChIKey is ZDAJSLOGXYNHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-9-13-11(12(2,3)16)15(14-9)10-7-5-4-6-8-10/h4-8,16H,1-3H3.
What are the key properties of 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol?
2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol has a molecular weight of 217.27 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propan-2-ol is sourced from PubChem (CID 659949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).