About spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane]
spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] (PubChem CID 659975) has the molecular formula C13H14N4
and a molecular weight of 226.28 g/mol. Its IUPAC name is spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane].
Molecular Properties
| Compound Name | spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] |
| PubChem CID | 659975 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)CC1(CCCC1)n1nnnc1-2 |
| InChI | InChI=1S/C13H14N4/c1-2-6-11-10(5-1)9-13(7-3-4-8-13)17-12(11)14-15-16-17/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | QNWUNSOOORTWDJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane]?
The IUPAC name of spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] (CID 659975) is spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane].
What is the SMILES notation for spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane]?
The canonical SMILES for spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] is c1ccc2c(c1)CC1(CCCC1)n1nnnc1-2.
What is the InChIKey of spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane]?
The InChIKey is QNWUNSOOORTWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4/c1-2-6-11-10(5-1)9-13(7-3-4-8-13)17-12(11)14-15-16-17/h1-2,5-6H,3-4,7-9H2.
What are the key properties of spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane]?
spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] has a molecular weight of 226.28 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6H-tetrazolo[5,1-a]isoquinoline-5,1'-cyclopentane] is sourced from PubChem (CID 659975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).