About [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine
[2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (PubChem CID 66000049) has the molecular formula C9H7Br2FN4O
and a molecular weight of 365.99 g/mol. Its IUPAC name is [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 66000049 |
| Molecular Formula | C9H7Br2FN4O |
| Molecular Weight | 365.99 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(-c2cc(Br)c(Br)o2)nc(NN)c1F |
| InChI | InChI=1S/C9H7Br2FN4O/c1-3-6(12)9(16-13)15-8(14-3)5-2-4(10)7(11)17-5/h2H,13H2,1H3,(H,14,15,16) |
| InChIKey | SONZMHYRXSBYBB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.99 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine (CID 66000049) is [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is Cc1nc(-c2cc(Br)c(Br)o2)nc(NN)c1F.
What is the InChIKey of [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
The InChIKey is SONZMHYRXSBYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Br2FN4O/c1-3-6(12)9(16-13)15-8(14-3)5-2-4(10)7(11)17-5/h2H,13H2,1H3,(H,14,15,16).
What are the key properties of [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine?
[2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine has a molecular weight of 365.99 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-dibromofuran-2-yl)-5-fluoro-6-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 66000049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).