About 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine
5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine (PubChem CID 66000575) has the molecular formula C10H14FN3O
and a molecular weight of 211.24 g/mol. Its IUPAC name is 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine |
| PubChem CID | 66000575 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine |
| SMILES | CNc1nc(C2CCCO2)nc(C)c1F |
| InChI | InChI=1S/C10H14FN3O/c1-6-8(11)10(12-2)14-9(13-6)7-4-3-5-15-7/h7H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | HBIMYPIJNOBJHA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine?
The IUPAC name of 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine (CID 66000575) is 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine.
What is the SMILES notation for 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine?
The canonical SMILES for 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine is CNc1nc(C2CCCO2)nc(C)c1F.
What is the InChIKey of 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine?
The InChIKey is HBIMYPIJNOBJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3O/c1-6-8(11)10(12-2)14-9(13-6)7-4-3-5-15-7/h7H,3-5H2,1-2H3,(H,12,13,14).
What are the key properties of 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine?
5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine has a molecular weight of 211.24 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,6-dimethyl-2-(oxolan-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 66000575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).