C16H27NO — CID 66001267
4-(tert-butylamino)-2-(2,4-dimethylphenyl)butan-2-ol (PubChem CID 66001267) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-(tert-butylamino)-2-(2,4-dimethylphenyl)butan-2-ol.
| Compound Name | 4-(tert-butylamino)-2-(2,4-dimethylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 66001267 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-(tert-butylamino)-2-(2,4-dimethylphenyl)butan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CCNC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H27NO/c1-12-7-8-14(13(2)11-12)16(6,18)9-10-17-15(3,4)5/h7-8,11,17-18H,9-10H2,1-6H3 |
| InChIKey | XUDDWQHKHZEUHH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |