C14H21F2NO — CID 66001269
4-(tert-butylamino)-2-(2,4-difluorophenyl)butan-2-ol (PubChem CID 66001269) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-(tert-butylamino)-2-(2,4-difluorophenyl)butan-2-ol.
| Compound Name | 4-(tert-butylamino)-2-(2,4-difluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 66001269 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-(tert-butylamino)-2-(2,4-difluorophenyl)butan-2-ol |
| SMILES | CC(C)(C)NCCC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2NO/c1-13(2,3)17-8-7-14(4,18)11-6-5-10(15)9-12(11)16/h5-6,9,17-18H,7-8H2,1-4H3 |
| InChIKey | PTKDBPSLBONLKZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |