C15H25NO2 — CID 66002283
2-(3,5-dimethylphenyl)-4-(2-methoxyethylamino)butan-2-ol (PubChem CID 66002283) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-(2-methoxyethylamino)butan-2-ol.
| Compound Name | 2-(3,5-dimethylphenyl)-4-(2-methoxyethylamino)butan-2-ol |
|---|---|
| PubChem CID | 66002283 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-(2-methoxyethylamino)butan-2-ol |
| SMILES | COCCNCCC(C)(O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H25NO2/c1-12-9-13(2)11-14(10-12)15(3,17)5-6-16-7-8-18-4/h9-11,16-17H,5-8H2,1-4H3 |
| InChIKey | HXXOMYDXKAMTPY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|