C10H20N2O5 — CID 66002629
3-hydroxy-4-[[2-hydroxypropyl(methyl)carbamoyl]amino]-3-methylbutanoic acid (PubChem CID 66002629) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-hydroxypropyl(methyl)carbamoyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-hydroxy-4-[[2-hydroxypropyl(methyl)carbamoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002629 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-hydroxy-4-[[2-hydroxypropyl(methyl)carbamoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(O)CN(C)C(=O)NCC(C)(O)CC(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-7(13)5-12(3)9(16)11-6-10(2,17)4-8(14)15/h7,13,17H,4-6H2,1-3H3,(H,11,16)(H,14,15) |
| InChIKey | JJQONIWISCFUBW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |