About [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 6600440) has the molecular formula C14H15F2NO5S
and a molecular weight of 347.34 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate.
Molecular Properties
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate |
| PubChem CID | 6600440 |
| Molecular Formula | C14H15F2NO5S |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(F)cc1F)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15F2NO5S/c1-17(10-4-5-23(20,21)8-10)13(18)7-22-14(19)11-3-2-9(15)6-12(11)16/h2-3,6,10H,4-5,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | AKNKYLMHAIWXLL-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The IUPAC name of [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate (CID 6600440) is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate.
What is the SMILES notation for [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The canonical SMILES for [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate is CN(C(=O)COC(=O)c1ccc(F)cc1F)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate?
The InChIKey is AKNKYLMHAIWXLL-JTQLQIEISA-N. The full InChI is InChI=1S/C14H15F2NO5S/c1-17(10-4-5-23(20,21)8-10)13(18)7-22-14(19)11-3-2-9(15)6-12(11)16/h2-3,6,10H,4-5,7-8H2,1H3/t10-/m0/s1.
What are the key properties of [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate?
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate has a molecular weight of 347.34 g/mol, XLogP of 0.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 2,4-difluorobenzoate is sourced from PubChem (CID 6600440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).