C9H16N2O — CID 66004927
N-[(3-aminocyclobutyl)methyl]cyclopropanecarboxamide (PubChem CID 66004927) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[(3-aminocyclobutyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(3-aminocyclobutyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 66004927 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[(3-aminocyclobutyl)methyl]cyclopropanecarboxamide |
| SMILES | NC1CC(CNC(=O)C2CC2)C1 |
| InChI | InChI=1S/C9H16N2O/c10-8-3-6(4-8)5-11-9(12)7-1-2-7/h6-8H,1-5,10H2,(H,11,12) |
| InChIKey | CPSNVUBAXUYSMK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |