C13H15BrFNO3 — CID 66005157
2-(4-bromo-2-fluorophenoxy)-N-[(3-hydroxycyclobutyl)methyl]acetamide (PubChem CID 66005157) has the molecular formula C13H15BrFNO3 and a molecular weight of 332.17 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-[(3-hydroxycyclobutyl)methyl]acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-[(3-hydroxycyclobutyl)methyl]acetamide |
|---|---|
| PubChem CID | 66005157 |
| Molecular Formula | C13H15BrFNO3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-[(3-hydroxycyclobutyl)methyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1F)NCC1CC(O)C1 |
| InChI | InChI=1S/C13H15BrFNO3/c14-9-1-2-12(11(15)5-9)19-7-13(18)16-6-8-3-10(17)4-8/h1-2,5,8,10,17H,3-4,6-7H2,(H,16,18) |
| InChIKey | RUELVQVPOBWDFU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |