About 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol
3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol (PubChem CID 66005694) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol |
| PubChem CID | 66005694 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol |
| SMILES | CC(C)c1nsc(NCC2CC(O)C2)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-6(2)9-12-10(15-13-9)11-5-7-3-8(14)4-7/h6-8,14H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | NBCNIOZWYSPILN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol?
The IUPAC name of 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol (CID 66005694) is 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol.
What is the SMILES notation for 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol?
The canonical SMILES for 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol is CC(C)c1nsc(NCC2CC(O)C2)n1.
What is the InChIKey of 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol?
The InChIKey is NBCNIOZWYSPILN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3OS/c1-6(2)9-12-10(15-13-9)11-5-7-3-8(14)4-7/h6-8,14H,3-5H2,1-2H3,(H,11,12,13).
What are the key properties of 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol?
3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol has a molecular weight of 227.33 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)amino]methyl]cyclobutan-1-ol is sourced from PubChem (CID 66005694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).