C11H18ClN3S — CID 66006089
3-tert-butyl-N-[(3-chlorocyclobutyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 66006089) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is 3-tert-butyl-N-[(3-chlorocyclobutyl)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-tert-butyl-N-[(3-chlorocyclobutyl)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 66006089 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-tert-butyl-N-[(3-chlorocyclobutyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)(C)c1nsc(NCC2CC(Cl)C2)n1 |
| InChI | InChI=1S/C11H18ClN3S/c1-11(2,3)9-14-10(16-15-9)13-6-7-4-8(12)5-7/h7-8H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | MMTCXGTZNYBJGJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|