C10H17NO2S — CID 66006893
N-[(3-hydroxycyclobutyl)methyl]thiolane-2-carboxamide (PubChem CID 66006893) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]thiolane-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 66006893 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]thiolane-2-carboxamide |
| SMILES | O=C(NCC1CC(O)C1)C1CCCS1 |
| InChI | InChI=1S/C10H17NO2S/c12-8-4-7(5-8)6-11-10(13)9-2-1-3-14-9/h7-9,12H,1-6H2,(H,11,13) |
| InChIKey | JHGKZMZXUCNNTK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |