About [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine
[5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine (PubChem CID 66009097) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine.
Molecular Properties
| Compound Name | [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine |
| PubChem CID | 66009097 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine |
| SMILES | COc1ccc(-c2cn(C)nc2C)cc1CN |
| InChI | InChI=1S/C13H17N3O/c1-9-12(8-16(2)15-9)10-4-5-13(17-3)11(6-10)7-14/h4-6,8H,7,14H2,1-3H3 |
| InChIKey | JHXVLEVWHSYAKF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine?
The IUPAC name of [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine (CID 66009097) is [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine.
What is the SMILES notation for [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine?
The canonical SMILES for [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine is COc1ccc(-c2cn(C)nc2C)cc1CN.
What is the InChIKey of [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine?
The InChIKey is JHXVLEVWHSYAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-9-12(8-16(2)15-9)10-4-5-13(17-3)11(6-10)7-14/h4-6,8H,7,14H2,1-3H3.
What are the key properties of [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine?
[5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine has a molecular weight of 231.30 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-dimethylpyrazol-4-yl)-2-methoxyphenyl]methanamine is sourced from PubChem (CID 66009097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).