About ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate
ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate (PubChem CID 66010372) has the molecular formula C13H12N2O5
and a molecular weight of 276.25 g/mol. Its IUPAC name is ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 66010372 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc3c(c2)OCO3)oc1N |
| InChI | InChI=1S/C13H12N2O5/c1-2-17-13(16)10-11(14)20-12(15-10)7-3-4-8-9(5-7)19-6-18-8/h3-5H,2,6,14H2,1H3 |
| InChIKey | IQHVWXBYXMIOHD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate (CID 66010372) is ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate is CCOC(=O)c1nc(-c2ccc3c(c2)OCO3)oc1N.
What is the InChIKey of ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate?
The InChIKey is IQHVWXBYXMIOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5/c1-2-17-13(16)10-11(14)20-12(15-10)7-3-4-8-9(5-7)19-6-18-8/h3-5H,2,6,14H2,1H3.
What are the key properties of ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate?
ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate has a molecular weight of 276.25 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-2-(1,3-benzodioxol-5-yl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 66010372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).