About 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile
5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile (PubChem CID 66010530) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 66010530 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1cc(-c2nc(C#N)c(N)o2)sc1C |
| InChI | InChI=1S/C10H9N3OS/c1-5-3-8(15-6(5)2)10-13-7(4-11)9(12)14-10/h3H,12H2,1-2H3 |
| InChIKey | MJCUVQWECOQRAT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile (CID 66010530) is 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile is Cc1cc(-c2nc(C#N)c(N)o2)sc1C.
What is the InChIKey of 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile?
The InChIKey is MJCUVQWECOQRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c1-5-3-8(15-6(5)2)10-13-7(4-11)9(12)14-10/h3H,12H2,1-2H3.
What are the key properties of 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile?
5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile has a molecular weight of 219.27 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(4,5-dimethylthiophen-2-yl)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 66010530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).