About 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine
1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine (PubChem CID 66012501) has the molecular formula C8H11N5S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine |
| PubChem CID | 66012501 |
| Molecular Formula | C8H11N5S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine |
| SMILES | CCn1nc(C)c(N)c1Sc1nncs1 |
| InChI | InChI=1S/C8H11N5S2/c1-3-13-7(6(9)5(2)12-13)15-8-11-10-4-14-8/h4H,3,9H2,1-2H3 |
| InChIKey | GNQMMQGTRDBASO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine?
The IUPAC name of 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine (CID 66012501) is 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine.
What is the SMILES notation for 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine?
The canonical SMILES for 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine is CCn1nc(C)c(N)c1Sc1nncs1.
What is the InChIKey of 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine?
The InChIKey is GNQMMQGTRDBASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5S2/c1-3-13-7(6(9)5(2)12-13)15-8-11-10-4-14-8/h4H,3,9H2,1-2H3.
What are the key properties of 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine?
1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine has a molecular weight of 241.34 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-5-(1,3,4-thiadiazol-2-ylsulfanyl)pyrazol-4-amine is sourced from PubChem (CID 66012501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).