C10H17F3N4O — CID 66012666
1-ethyl-3-methyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine (PubChem CID 66012666) has the molecular formula C10H17F3N4O and a molecular weight of 266.27 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine.
| Compound Name | 1-ethyl-3-methyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66012666 |
| Molecular Formula | C10H17F3N4O |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-ethyl-3-methyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N4O/c1-3-17-9(8(14)7(2)16-17)15-4-5-18-6-10(11,12)13/h15H,3-6,14H2,1-2H3 |
| InChIKey | OZPKZNBSHJDIPZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|