C11H19F3N4O — CID 66012728
1-methyl-3-propan-2-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine (PubChem CID 66012728) has the molecular formula C11H19F3N4O and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-methyl-3-propan-2-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine.
| Compound Name | 1-methyl-3-propan-2-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66012728 |
| Molecular Formula | C11H19F3N4O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-methyl-3-propan-2-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
| SMILES | CC(C)c1nn(C)c(NCCOCC(F)(F)F)c1N |
| InChI | InChI=1S/C11H19F3N4O/c1-7(2)9-8(15)10(18(3)17-9)16-4-5-19-6-11(12,13)14/h7,16H,4-6,15H2,1-3H3 |
| InChIKey | HDUYTXWIXOBNNK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|