C18H16N2O3 — CID 660129
(10aS)-2-(4-methoxyphenyl)-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione (PubChem CID 660129) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (10aS)-2-(4-methoxyphenyl)-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione.
| Compound Name | (10aS)-2-(4-methoxyphenyl)-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 660129 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (10aS)-2-(4-methoxyphenyl)-10,10a-dihydro-5H-imidazo[1,5-b]isoquinoline-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C18H16N2O3/c1-23-15-8-6-14(7-9-15)20-17(21)16-10-12-4-2-3-5-13(12)11-19(16)18(20)22/h2-9,16H,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | VQQPGGPRSKOZRP-INIZCTEOSA-N |
| XLogP | 2.59 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|