C11H18N4O4S — CID 66013301
N-(1,1-dioxothiolan-3-yl)-3-methyl-4-nitro-1-propylpyrazol-5-amine (PubChem CID 66013301) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-methyl-4-nitro-1-propylpyrazol-5-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-methyl-4-nitro-1-propylpyrazol-5-amine |
|---|---|
| PubChem CID | 66013301 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-methyl-4-nitro-1-propylpyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H18N4O4S/c1-3-5-14-11(10(15(16)17)8(2)13-14)12-9-4-6-20(18,19)7-9/h9,12H,3-7H2,1-2H3 |
| InChIKey | FHKVICIRBUNNNV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|