About 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine
3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine (PubChem CID 66014379) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine |
| PubChem CID | 66014379 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine |
| SMILES | CCCN(C)c1c(N)c(CC)nn1C |
| InChI | InChI=1S/C10H20N4/c1-5-7-13(3)10-9(11)8(6-2)12-14(10)4/h5-7,11H2,1-4H3 |
| InChIKey | CIBPAARVOAUKAN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine?
The IUPAC name of 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine (CID 66014379) is 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine.
What is the SMILES notation for 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine?
The canonical SMILES for 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine is CCCN(C)c1c(N)c(CC)nn1C.
What is the InChIKey of 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine?
The InChIKey is CIBPAARVOAUKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-5-7-13(3)10-9(11)8(6-2)12-14(10)4/h5-7,11H2,1-4H3.
What are the key properties of 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine?
3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine has a molecular weight of 196.30 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-N,1-dimethyl-5-N-propylpyrazole-4,5-diamine is sourced from PubChem (CID 66014379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).