About 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine
3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine (PubChem CID 66014630) has the molecular formula C12H20F3N5
and a molecular weight of 291.32 g/mol. Its IUPAC name is 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine |
| PubChem CID | 66014630 |
| Molecular Formula | C12H20F3N5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine |
| SMILES | CCc1nn(C)c(N2CCN(CC(F)(F)F)CC2)c1N |
| InChI | InChI=1S/C12H20F3N5/c1-3-9-10(16)11(18(2)17-9)20-6-4-19(5-7-20)8-12(13,14)15/h3-8,16H2,1-2H3 |
| InChIKey | WAQYEKFZIUEZDK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine?
The IUPAC name of 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine (CID 66014630) is 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine.
What is the SMILES notation for 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine?
The canonical SMILES for 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine is CCc1nn(C)c(N2CCN(CC(F)(F)F)CC2)c1N.
What is the InChIKey of 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine?
The InChIKey is WAQYEKFZIUEZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N5/c1-3-9-10(16)11(18(2)17-9)20-6-4-19(5-7-20)8-12(13,14)15/h3-8,16H2,1-2H3.
What are the key properties of 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine?
3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine has a molecular weight of 291.32 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazol-4-amine is sourced from PubChem (CID 66014630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).