About 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one
3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one (PubChem CID 660150) has the molecular formula C19H18N2O5
and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one.
Molecular Properties
| Compound Name | 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one |
| PubChem CID | 660150 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one |
| SMILES | COc1ccc(C2C(C(C)=O)=C(O)C(=O)N2c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-11(22)16-17(14-7-6-13(25-2)9-15(14)26-3)21(19(24)18(16)23)12-5-4-8-20-10-12/h4-10,17,23H,1-3H3 |
| InChIKey | KFDDKGASDIPLEI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one?
The IUPAC name of 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one (CID 660150) is 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one.
What is the SMILES notation for 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one?
The canonical SMILES for 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one is COc1ccc(C2C(C(C)=O)=C(O)C(=O)N2c2cccnc2)c(OC)c1.
What is the InChIKey of 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one?
The InChIKey is KFDDKGASDIPLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5/c1-11(22)16-17(14-7-6-13(25-2)9-15(14)26-3)21(19(24)18(16)23)12-5-4-8-20-10-12/h4-10,17,23H,1-3H3.
What are the key properties of 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one?
3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one has a molecular weight of 354.36 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-(2,4-dimethoxyphenyl)-4-hydroxy-1-pyridin-3-yl-2H-pyrrol-5-one is sourced from PubChem (CID 660150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).