C14H12ClF3N2 — CID 66016707
3-chloro-2-(2,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazole (PubChem CID 66016707) has the molecular formula C14H12ClF3N2 and a molecular weight of 300.71 g/mol. Its IUPAC name is 3-chloro-2-(2,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazole.
| Compound Name | 3-chloro-2-(2,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazole |
|---|---|
| PubChem CID | 66016707 |
| Molecular Formula | C14H12ClF3N2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-chloro-2-(2,4,5-trifluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrazole |
| SMILES | Fc1cc(F)c(-n2nc3c(c2Cl)CCCCC3)cc1F |
| InChI | InChI=1S/C14H12ClF3N2/c15-14-8-4-2-1-3-5-12(8)19-20(14)13-7-10(17)9(16)6-11(13)18/h6-7H,1-5H2 |
| InChIKey | PTACNODBEKKEQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|