About 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine
5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine (PubChem CID 66016939) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine |
| PubChem CID | 66016939 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine |
| SMILES | CCCCN(C)c1c(N)c(CC)nn1C |
| InChI | InChI=1S/C11H22N4/c1-5-7-8-14(3)11-10(12)9(6-2)13-15(11)4/h5-8,12H2,1-4H3 |
| InChIKey | DASABLZMHALFCX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine?
The IUPAC name of 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine (CID 66016939) is 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine.
What is the SMILES notation for 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine?
The canonical SMILES for 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine is CCCCN(C)c1c(N)c(CC)nn1C.
What is the InChIKey of 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine?
The InChIKey is DASABLZMHALFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4/c1-5-7-8-14(3)11-10(12)9(6-2)13-15(11)4/h5-8,12H2,1-4H3.
What are the key properties of 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine?
5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine has a molecular weight of 210.32 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-butyl-3-ethyl-5-N,1-dimethylpyrazole-4,5-diamine is sourced from PubChem (CID 66016939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).