About 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone
1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone (PubChem CID 660175) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone.
Molecular Properties
| Compound Name | 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone |
| PubChem CID | 660175 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone |
| SMILES | Cc1cc2ncn(C(=O)c3ccc4c(c3)OCO4)c2cc1C |
| InChI | InChI=1S/C17H14N2O3/c1-10-5-13-14(6-11(10)2)19(8-18-13)17(20)12-3-4-15-16(7-12)22-9-21-15/h3-8H,9H2,1-2H3 |
| InChIKey | GCAOJSYUHIWDPA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone?
The IUPAC name of 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone (CID 660175) is 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone.
What is the SMILES notation for 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone?
The canonical SMILES for 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone is Cc1cc2ncn(C(=O)c3ccc4c(c3)OCO4)c2cc1C.
What is the InChIKey of 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone?
The InChIKey is GCAOJSYUHIWDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c1-10-5-13-14(6-11(10)2)19(8-18-13)17(20)12-3-4-15-16(7-12)22-9-21-15/h3-8H,9H2,1-2H3.
What are the key properties of 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone?
1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone has a molecular weight of 294.31 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxol-5-yl-(5,6-dimethylbenzimidazol-1-yl)methanone is sourced from PubChem (CID 660175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).