C12H22N4O — CID 66017732
1-methyl-5-N-(oxan-3-yl)-3-propylpyrazole-4,5-diamine (PubChem CID 66017732) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-methyl-5-N-(oxan-3-yl)-3-propylpyrazole-4,5-diamine.
| Compound Name | 1-methyl-5-N-(oxan-3-yl)-3-propylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66017732 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-methyl-5-N-(oxan-3-yl)-3-propylpyrazole-4,5-diamine |
| SMILES | CCCc1nn(C)c(NC2CCCOC2)c1N |
| InChI | InChI=1S/C12H22N4O/c1-3-5-10-11(13)12(16(2)15-10)14-9-6-4-7-17-8-9/h9,14H,3-8,13H2,1-2H3 |
| InChIKey | VOKZNGUFOCMGNE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |