About 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine
5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine (PubChem CID 66018191) has the molecular formula C12H22N4S
and a molecular weight of 254.40 g/mol. Its IUPAC name is 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine |
| PubChem CID | 66018191 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine |
| SMILES | CC(C)c1nn(C)c(N(C)C2CCSC2)c1N |
| InChI | InChI=1S/C12H22N4S/c1-8(2)11-10(13)12(16(4)14-11)15(3)9-5-6-17-7-9/h8-9H,5-7,13H2,1-4H3 |
| InChIKey | KAMZFQYEHKLYHM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine?
The IUPAC name of 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine (CID 66018191) is 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine.
What is the SMILES notation for 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine?
The canonical SMILES for 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine is CC(C)c1nn(C)c(N(C)C2CCSC2)c1N.
What is the InChIKey of 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine?
The InChIKey is KAMZFQYEHKLYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4S/c1-8(2)11-10(13)12(16(4)14-11)15(3)9-5-6-17-7-9/h8-9H,5-7,13H2,1-4H3.
What are the key properties of 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine?
5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine has a molecular weight of 254.40 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N,1-dimethyl-3-propan-2-yl-5-N-(thiolan-3-yl)pyrazole-4,5-diamine is sourced from PubChem (CID 66018191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).