C10H19N5O — CID 66018193
2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-N-methylacetamide (PubChem CID 66018193) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-N-methylacetamide.
| Compound Name | 2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 66018193 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-[(4-amino-1-methyl-3-propan-2-ylpyrazol-5-yl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1c(N)c(C(C)C)nn1C |
| InChI | InChI=1S/C10H19N5O/c1-6(2)9-8(11)10(15(4)14-9)13-5-7(16)12-3/h6,13H,5,11H2,1-4H3,(H,12,16) |
| InChIKey | SXLPFVFHPBRRRD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |