About 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine
1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine (PubChem CID 66018504) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine |
| PubChem CID | 66018504 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine |
| SMILES | CCCc1nn(C)c(N2CCCOC(C)C2)c1N |
| InChI | InChI=1S/C13H24N4O/c1-4-6-11-12(14)13(16(3)15-11)17-7-5-8-18-10(2)9-17/h10H,4-9,14H2,1-3H3 |
| InChIKey | KQJBPLNZCFKEHF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine?
The IUPAC name of 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine (CID 66018504) is 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine.
What is the SMILES notation for 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine?
The canonical SMILES for 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine is CCCc1nn(C)c(N2CCCOC(C)C2)c1N.
What is the InChIKey of 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine?
The InChIKey is KQJBPLNZCFKEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-4-6-11-12(14)13(16(3)15-11)17-7-5-8-18-10(2)9-17/h10H,4-9,14H2,1-3H3.
What are the key properties of 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine?
1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine has a molecular weight of 252.36 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(2-methyl-1,4-oxazepan-4-yl)-3-propylpyrazol-4-amine is sourced from PubChem (CID 66018504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).