C15H19F3N2O4 — CID 660191
methyl 2-[4-(butylcarbamoylamino)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 660191) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is methyl 2-[4-(butylcarbamoylamino)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | methyl 2-[4-(butylcarbamoylamino)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 660191 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 2-[4-(butylcarbamoylamino)phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCCCNC(=O)Nc1ccc(C(O)(C(=O)OC)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O4/c1-3-4-9-19-13(22)20-11-7-5-10(6-8-11)14(23,12(21)24-2)15(16,17)18/h5-8,23H,3-4,9H2,1-2H3,(H2,19,20,22) |
| InChIKey | CFPOKRPHFYVLTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|