C12H17N3OS — CID 66019505
1-methyl-3-propyl-5-(thiophen-2-ylmethoxy)pyrazol-4-amine (PubChem CID 66019505) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-methyl-3-propyl-5-(thiophen-2-ylmethoxy)pyrazol-4-amine.
| Compound Name | 1-methyl-3-propyl-5-(thiophen-2-ylmethoxy)pyrazol-4-amine |
|---|---|
| PubChem CID | 66019505 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-methyl-3-propyl-5-(thiophen-2-ylmethoxy)pyrazol-4-amine |
| SMILES | CCCc1nn(C)c(OCc2cccs2)c1N |
| InChI | InChI=1S/C12H17N3OS/c1-3-5-10-11(13)12(15(2)14-10)16-8-9-6-4-7-17-9/h4,6-7H,3,5,8,13H2,1-2H3 |
| InChIKey | IJKDFRKRMICIDB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |