C13H25N5O3 — CID 66019622
N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4-nitro-3-propylpyrazol-5-yl)ethane-1,2-diamine (PubChem CID 66019622) has the molecular formula C13H25N5O3 and a molecular weight of 299.38 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4-nitro-3-propylpyrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4-nitro-3-propylpyrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66019622 |
| Molecular Formula | C13H25N5O3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4-nitro-3-propylpyrazol-5-yl)ethane-1,2-diamine |
| SMILES | CCCc1nn(C)c(NCCN(C)CCOC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H25N5O3/c1-5-6-11-12(18(19)20)13(17(3)15-11)14-7-8-16(2)9-10-21-4/h14H,5-10H2,1-4H3 |
| InChIKey | OLYWQKXJOXSTIU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|