About 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile
2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile (PubChem CID 660200) has the molecular formula C18H16BrN3O3
and a molecular weight of 402.25 g/mol. Its IUPAC name is 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile |
| PubChem CID | 660200 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile |
| SMILES | CC(C)(C)C1=C(C#N)C(c2cc3c(cc2Br)OCO3)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C18H16BrN3O3/c1-18(2,3)16-10(6-20)15(11(7-21)17(22)25-16)9-4-13-14(5-12(9)19)24-8-23-13/h4-5,15H,8,22H2,1-3H3 |
| InChIKey | QVVAQOBOUZISFJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile (CID 660200) is 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile is CC(C)(C)C1=C(C#N)C(c2cc3c(cc2Br)OCO3)C(C#N)=C(N)O1.
What is the InChIKey of 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile?
The InChIKey is QVVAQOBOUZISFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3O3/c1-18(2,3)16-10(6-20)15(11(7-21)17(22)25-16)9-4-13-14(5-12(9)19)24-8-23-13/h4-5,15H,8,22H2,1-3H3.
What are the key properties of 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile?
2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile has a molecular weight of 402.25 g/mol, XLogP of 3.81, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(6-bromo-1,3-benzodioxol-5-yl)-6-tert-butyl-4H-pyran-3,5-dicarbonitrile is sourced from PubChem (CID 660200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).