C7H13N3O2S — CID 66020430
3-methyl-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 66020430) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 3-methyl-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | 3-methyl-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 66020430 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-methyl-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H13N3O2S/c1-5(2)10-4-7(6(3)9-10)13(8,11)12/h4-5H,1-3H3,(H2,8,11,12) |
| InChIKey | VREXESIGMQFVSJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |