C9H14N2O — CID 66022116
2-ethyl-4,5,6,7-tetrahydro-1H-indazol-3-one (PubChem CID 66022116) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-ethyl-4,5,6,7-tetrahydro-1H-indazol-3-one.
| Compound Name | 2-ethyl-4,5,6,7-tetrahydro-1H-indazol-3-one |
|---|---|
| PubChem CID | 66022116 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-ethyl-4,5,6,7-tetrahydro-1H-indazol-3-one |
| SMILES | CCn1[nH]c2c(c1=O)CCCC2 |
| InChI | InChI=1S/C9H14N2O/c1-2-11-9(12)7-5-3-4-6-8(7)10-11/h10H,2-6H2,1H3 |
| InChIKey | KXUHPEFFFISYHA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |