About 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one
2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one (PubChem CID 66023349) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one.
Molecular Properties
| Compound Name | 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one |
| PubChem CID | 66023349 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one |
| SMILES | CCCCn1[nH]c2c(c1=O)CCC2 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-7-12-10(13)8-5-4-6-9(8)11-12/h11H,2-7H2,1H3 |
| InChIKey | PSGYATBTYDBSQP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The IUPAC name of 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one (CID 66023349) is 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one.
What is the SMILES notation for 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The canonical SMILES for 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one is CCCCn1[nH]c2c(c1=O)CCC2.
What is the InChIKey of 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
The InChIKey is PSGYATBTYDBSQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-7-12-10(13)8-5-4-6-9(8)11-12/h11H,2-7H2,1H3.
What are the key properties of 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one?
2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one has a molecular weight of 180.25 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one is sourced from PubChem (CID 66023349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).