C12H15BrO2 — CID 66023451
[1-[(5-bromo-2-methoxyphenyl)methyl]cyclopropyl]methanol (PubChem CID 66023451) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is [1-[(5-bromo-2-methoxyphenyl)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(5-bromo-2-methoxyphenyl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 66023451 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | [1-[(5-bromo-2-methoxyphenyl)methyl]cyclopropyl]methanol |
| SMILES | COc1ccc(Br)cc1CC1(CO)CC1 |
| InChI | InChI=1S/C12H15BrO2/c1-15-11-3-2-10(13)6-9(11)7-12(8-14)4-5-12/h2-3,6,14H,4-5,7-8H2,1H3 |
| InChIKey | HQDZWIFPSRSEQJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |