About [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol
[4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol (PubChem CID 66024950) has the molecular formula C15H28O3S
and a molecular weight of 288.45 g/mol. Its IUPAC name is [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol |
| PubChem CID | 66024950 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol |
| SMILES | CCCCC1CCC(CO)(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H28O3S/c1-2-3-4-13-5-8-15(12-16,9-6-13)14-7-10-19(17,18)11-14/h13-14,16H,2-12H2,1H3 |
| InChIKey | XVBAVYFWOXPCNQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol?
The IUPAC name of [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol (CID 66024950) is [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol.
What is the SMILES notation for [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol?
The canonical SMILES for [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol is CCCCC1CCC(CO)(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol?
The InChIKey is XVBAVYFWOXPCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3S/c1-2-3-4-13-5-8-15(12-16,9-6-13)14-7-10-19(17,18)11-14/h13-14,16H,2-12H2,1H3.
What are the key properties of [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol?
[4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol has a molecular weight of 288.45 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-butyl-1-(1,1-dioxothiolan-3-yl)cyclohexyl]methanol is sourced from PubChem (CID 66024950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).