C15H24N2O3S — CID 66025176
3-(1-cyclopentylpyrazol-3-yl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol (PubChem CID 66025176) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-(1-cyclopentylpyrazol-3-yl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol.
| Compound Name | 3-(1-cyclopentylpyrazol-3-yl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 66025176 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(1-cyclopentylpyrazol-3-yl)-2-(1,1-dioxothiolan-3-yl)propan-1-ol |
| SMILES | O=S1(=O)CCC(C(CO)Cc2ccn(C3CCCC3)n2)C1 |
| InChI | InChI=1S/C15H24N2O3S/c18-10-13(12-6-8-21(19,20)11-12)9-14-5-7-17(16-14)15-3-1-2-4-15/h5,7,12-13,15,18H,1-4,6,8-11H2 |
| InChIKey | LCKYJRLVSCHYOL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |